C9H13N5 — CID 126986977
3-[[6-(ethylamino)pyrazin-2-yl]amino]propanenitrile (PubChem CID 126986977) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 3-[[6-(ethylamino)pyrazin-2-yl]amino]propanenitrile.
| Compound Name | 3-[[6-(ethylamino)pyrazin-2-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 126986977 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 3-[[6-(ethylamino)pyrazin-2-yl]amino]propanenitrile |
| SMILES | CCNc1cncc(NCCC#N)n1 |
| InChI | InChI=1S/C9H13N5/c1-2-12-8-6-11-7-9(14-8)13-5-3-4-10/h6-7H,2-3,5H2,1H3,(H2,12,13,14) |
| InChIKey | GZDZRDCBTYCWGD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|