C14H14N4O — CID 116971959
3-[[6-(3-methoxyphenyl)pyridazin-3-yl]amino]propanenitrile (PubChem CID 116971959) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[[6-(3-methoxyphenyl)pyridazin-3-yl]amino]propanenitrile.
| Compound Name | 3-[[6-(3-methoxyphenyl)pyridazin-3-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 116971959 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-[[6-(3-methoxyphenyl)pyridazin-3-yl]amino]propanenitrile |
| SMILES | COc1cccc(-c2ccc(NCCC#N)nn2)c1 |
| InChI | InChI=1S/C14H14N4O/c1-19-12-5-2-4-11(10-12)13-6-7-14(18-17-13)16-9-3-8-15/h2,4-7,10H,3,9H2,1H3,(H,16,18) |
| InChIKey | YARAGPMBULCNJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|