C14H13FN4 — CID 116971924
3-[[6-(4-fluoro-3-methylphenyl)pyridazin-3-yl]amino]propanenitrile (PubChem CID 116971924) has the molecular formula C14H13FN4 and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-[[6-(4-fluoro-3-methylphenyl)pyridazin-3-yl]amino]propanenitrile.
| Compound Name | 3-[[6-(4-fluoro-3-methylphenyl)pyridazin-3-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 116971924 |
| Molecular Formula | C14H13FN4 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-[[6-(4-fluoro-3-methylphenyl)pyridazin-3-yl]amino]propanenitrile |
| SMILES | Cc1cc(-c2ccc(NCCC#N)nn2)ccc1F |
| InChI | InChI=1S/C14H13FN4/c1-10-9-11(3-4-12(10)15)13-5-6-14(19-18-13)17-8-2-7-16/h3-6,9H,2,8H2,1H3,(H,17,19) |
| InChIKey | QAKBITIPRWTQJO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|