C14H11N5O — CID 91017571
2-amino-4-benzylpteridine-6-carbaldehyde (PubChem CID 91017571) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-amino-4-benzylpteridine-6-carbaldehyde.
| Compound Name | 2-amino-4-benzylpteridine-6-carbaldehyde |
|---|---|
| PubChem CID | 91017571 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-amino-4-benzylpteridine-6-carbaldehyde |
| SMILES | Nc1nc(Cc2ccccc2)c2nc(C=O)cnc2n1 |
| InChI | InChI=1S/C14H11N5O/c15-14-18-11(6-9-4-2-1-3-5-9)12-13(19-14)16-7-10(8-20)17-12/h1-5,7-8H,6H2,(H2,15,16,18,19) |
| InChIKey | OLPDRXDNMBMYJV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|