C15H14N4 — CID 154180418
4-benzyl-6,7-dimethylpteridine (PubChem CID 154180418) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-benzyl-6,7-dimethylpteridine.
| Compound Name | 4-benzyl-6,7-dimethylpteridine |
|---|---|
| PubChem CID | 154180418 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-benzyl-6,7-dimethylpteridine |
| SMILES | Cc1nc2ncnc(Cc3ccccc3)c2nc1C |
| InChI | InChI=1S/C15H14N4/c1-10-11(2)19-15-14(18-10)13(16-9-17-15)8-12-6-4-3-5-7-12/h3-7,9H,8H2,1-2H3 |
| InChIKey | JSKUCHUJILKKOS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |