C14H17N5 — CID 144791619
8-benzyl-7H-purin-6-amine;ethane (PubChem CID 144791619) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is 8-benzyl-7H-purin-6-amine;ethane.
| Compound Name | 8-benzyl-7H-purin-6-amine;ethane |
|---|---|
| PubChem CID | 144791619 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 8-benzyl-7H-purin-6-amine;ethane |
| SMILES | CC.Nc1ncnc2nc(Cc3ccccc3)[nH]c12 |
| InChI | InChI=1S/C12H11N5.C2H6/c13-11-10-12(15-7-14-11)17-9(16-10)6-8-4-2-1-3-5-8;1-2/h1-5,7H,6H2,(H3,13,14,15,16,17);1-2H3 |
| InChIKey | FUTMXPSWRLKBFF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |