C12H20N6 — CID 114608052
8-(5-amino-3,3-dimethylpentyl)-7H-purin-6-amine (PubChem CID 114608052) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is 8-(5-amino-3,3-dimethylpentyl)-7H-purin-6-amine.
| Compound Name | 8-(5-amino-3,3-dimethylpentyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 114608052 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 8-(5-amino-3,3-dimethylpentyl)-7H-purin-6-amine |
| SMILES | CC(C)(CCN)CCc1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C12H20N6/c1-12(2,5-6-13)4-3-8-17-9-10(14)15-7-16-11(9)18-8/h7H,3-6,13H2,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | LQRQQXVPMCTUAO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |