About 5-benzyl-2,3-dimethylimidazol-4-amine
5-benzyl-2,3-dimethylimidazol-4-amine (PubChem CID 62225752) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-benzyl-2,3-dimethylimidazol-4-amine.
Molecular Properties
| Compound Name | 5-benzyl-2,3-dimethylimidazol-4-amine |
| PubChem CID | 62225752 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 5-benzyl-2,3-dimethylimidazol-4-amine |
| SMILES | Cc1nc(Cc2ccccc2)c(N)n1C |
| InChI | InChI=1S/C12H15N3/c1-9-14-11(12(13)15(9)2)8-10-6-4-3-5-7-10/h3-7H,8,13H2,1-2H3 |
| InChIKey | YKYJOFUUVHMFNO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-2,3-dimethylimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2,3-dimethylimidazol-4-amine?
The IUPAC name of 5-benzyl-2,3-dimethylimidazol-4-amine (CID 62225752) is 5-benzyl-2,3-dimethylimidazol-4-amine.
What is the SMILES notation for 5-benzyl-2,3-dimethylimidazol-4-amine?
The canonical SMILES for 5-benzyl-2,3-dimethylimidazol-4-amine is Cc1nc(Cc2ccccc2)c(N)n1C.
What is the InChIKey of 5-benzyl-2,3-dimethylimidazol-4-amine?
The InChIKey is YKYJOFUUVHMFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-9-14-11(12(13)15(9)2)8-10-6-4-3-5-7-10/h3-7H,8,13H2,1-2H3.
What are the key properties of 5-benzyl-2,3-dimethylimidazol-4-amine?
5-benzyl-2,3-dimethylimidazol-4-amine has a molecular weight of 201.27 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2,3-dimethylimidazol-4-amine is sourced from PubChem (CID 62225752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).