C11H21N3 — CID 62226133
5-hexyl-2,3-dimethylimidazol-4-amine (PubChem CID 62226133) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-hexyl-2,3-dimethylimidazol-4-amine.
| Compound Name | 5-hexyl-2,3-dimethylimidazol-4-amine |
|---|---|
| PubChem CID | 62226133 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 5-hexyl-2,3-dimethylimidazol-4-amine |
| SMILES | CCCCCCc1nc(C)n(C)c1N |
| InChI | InChI=1S/C11H21N3/c1-4-5-6-7-8-10-11(12)14(3)9(2)13-10/h4-8,12H2,1-3H3 |
| InChIKey | DPMVQDUWSUIHGN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|