C16H30N4 — CID 63468221
2-cyclohexyl-4-heptylimidazole-1,5-diamine (PubChem CID 63468221) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-cyclohexyl-4-heptylimidazole-1,5-diamine.
| Compound Name | 2-cyclohexyl-4-heptylimidazole-1,5-diamine |
|---|---|
| PubChem CID | 63468221 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 2-cyclohexyl-4-heptylimidazole-1,5-diamine |
| SMILES | CCCCCCCc1nc(C2CCCCC2)n(N)c1N |
| InChI | InChI=1S/C16H30N4/c1-2-3-4-5-9-12-14-15(17)20(18)16(19-14)13-10-7-6-8-11-13/h13H,2-12,17-18H2,1H3 |
| InChIKey | LANDYYMZSHBOKC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|