C21H21N — CID 139645873
3,4-dibenzyl-2,6-dimethylpyridine (PubChem CID 139645873) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is 3,4-dibenzyl-2,6-dimethylpyridine.
| Compound Name | 3,4-dibenzyl-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 139645873 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3,4-dibenzyl-2,6-dimethylpyridine |
| SMILES | Cc1cc(Cc2ccccc2)c(Cc2ccccc2)c(C)n1 |
| InChI | InChI=1S/C21H21N/c1-16-13-20(14-18-9-5-3-6-10-18)21(17(2)22-16)15-19-11-7-4-8-12-19/h3-13H,14-15H2,1-2H3 |
| InChIKey | RMBORHLXVOCDEC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |