About 6-benzylpurin-9-amine;copper
6-benzylpurin-9-amine;copper (PubChem CID 174669036) has the molecular formula C12H11CuN5
and a molecular weight of 288.80 g/mol. Its IUPAC name is 6-benzylpurin-9-amine;copper.
Molecular Properties
| Compound Name | 6-benzylpurin-9-amine;copper |
| PubChem CID | 174669036 |
| Molecular Formula | C12H11CuN5 |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 6-benzylpurin-9-amine;copper |
| SMILES | Nn1cnc2c(Cc3ccccc3)ncnc21.[Cu] |
| InChI | InChI=1S/C12H11N5.Cu/c13-17-8-16-11-10(14-7-15-12(11)17)6-9-4-2-1-3-5-9;/h1-5,7-8H,6,13H2; |
| InChIKey | RTWZCVMJXLMOPU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-benzylpurin-9-amine;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzylpurin-9-amine;copper?
The IUPAC name of 6-benzylpurin-9-amine;copper (CID 174669036) is 6-benzylpurin-9-amine;copper.
What is the SMILES notation for 6-benzylpurin-9-amine;copper?
The canonical SMILES for 6-benzylpurin-9-amine;copper is Nn1cnc2c(Cc3ccccc3)ncnc21.[Cu].
What is the InChIKey of 6-benzylpurin-9-amine;copper?
The InChIKey is RTWZCVMJXLMOPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5.Cu/c13-17-8-16-11-10(14-7-15-12(11)17)6-9-4-2-1-3-5-9;/h1-5,7-8H,6,13H2;.
What are the key properties of 6-benzylpurin-9-amine;copper?
6-benzylpurin-9-amine;copper has a molecular weight of 288.80 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzylpurin-9-amine;copper is sourced from PubChem (CID 174669036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).