C14H16N7O3P — CID 46918286
[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methylphosphonic acid (PubChem CID 46918286) has the molecular formula C14H16N7O3P and a molecular weight of 361.30 g/mol. Its IUPAC name is [4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methylphosphonic acid.
| Compound Name | [4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 46918286 |
| Molecular Formula | C14H16N7O3P |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]methylphosphonic acid |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(CP(=O)(O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C14H16N7O3P/c15-12-11-13(21-14(16)20-12)18-6-10(19-11)5-17-9-3-1-8(2-4-9)7-25(22,23)24/h1-4,6,17H,5,7H2,(H2,22,23,24)(H4,15,16,18,20,21) |
| InChIKey | YXFUKVYDMJKBEE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 173.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|