C22H31N9O3Si — CID 152852519
4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[4-[2-[hydroxy(dimethyl)silyl]ethylamino]-4-oxobutyl]benzamide (PubChem CID 152852519) has the molecular formula C22H31N9O3Si and a molecular weight of 497.64 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[4-[2-[hydroxy(dimethyl)silyl]ethylamino]-4-oxobutyl]benzamide.
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[4-[2-[hydroxy(dimethyl)silyl]ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 152852519 |
| Molecular Formula | C22H31N9O3Si |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methylamino]-N-[4-[2-[hydroxy(dimethyl)silyl]ethylamino]-4-oxobutyl]benzamide |
| SMILES | C[Si](C)(O)CCNC(=O)CCCNC(=O)c1ccc(NCc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C22H31N9O3Si/c1-35(2,34)11-10-25-17(32)4-3-9-26-21(33)14-5-7-15(8-6-14)27-12-16-13-28-20-18(29-16)19(23)30-22(24)31-20/h5-8,13,27,34H,3-4,9-12H2,1-2H3,(H,25,32)(H,26,33)(H4,23,24,28,30,31) |
| InChIKey | TVQQQBOIVHAFFJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 194.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|