C17H18N6O2 — CID 14503198
methyl 4-[2-(2,4-diaminopteridin-6-yl)propyl]benzoate (PubChem CID 14503198) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is methyl 4-[2-(2,4-diaminopteridin-6-yl)propyl]benzoate.
| Compound Name | methyl 4-[2-(2,4-diaminopteridin-6-yl)propyl]benzoate |
|---|---|
| PubChem CID | 14503198 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | methyl 4-[2-(2,4-diaminopteridin-6-yl)propyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(C)c2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C17H18N6O2/c1-9(7-10-3-5-11(6-4-10)16(24)25-2)12-8-20-15-13(21-12)14(18)22-17(19)23-15/h3-6,8-9H,7H2,1-2H3,(H4,18,19,20,22,23) |
| InChIKey | OLIRXWGTGARQIU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |