About [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate
[4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate (PubChem CID 73442319) has the molecular formula C18H20N8O3S
and a molecular weight of 428.48 g/mol. Its IUPAC name is [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate.
Molecular Properties
| Compound Name | [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate |
| PubChem CID | 73442319 |
| Molecular Formula | C18H20N8O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate |
| SMILES | CC(=O)N(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(OC(=O)C(N)CS)cc1 |
| InChI | InChI=1S/C18H20N8O3S/c1-9(27)26(11-2-4-12(5-3-11)29-17(28)13(19)8-30)7-10-6-22-16-14(23-10)15(20)24-18(21)25-16/h2-6,13,30H,7-8,19H2,1H3,(H4,20,21,22,24,25) |
| InChIKey | YQOAKOUCNLWPAD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 176.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate?
The IUPAC name of [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate (CID 73442319) is [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate.
What is the SMILES notation for [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate?
The canonical SMILES for [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate is CC(=O)N(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(OC(=O)C(N)CS)cc1.
What is the InChIKey of [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate?
The InChIKey is YQOAKOUCNLWPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N8O3S/c1-9(27)26(11-2-4-12(5-3-11)29-17(28)13(19)8-30)7-10-6-22-16-14(23-10)15(20)24-18(21)25-16/h2-6,13,30H,7-8,19H2,1H3,(H4,20,21,22,24,25).
What are the key properties of [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate?
[4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate has a molecular weight of 428.48 g/mol, XLogP of 0.30, 6 rotatable bonds, 4 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[acetyl-[(2,4-diaminopteridin-6-yl)methyl]amino]phenyl] 2-amino-3-sulfanylpropanoate is sourced from PubChem (CID 73442319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).