C14H14N6 — CID 154099945
6-methyl-5-phenylpyrido[2,3-d]pyrimidine-2,4,7-triamine (PubChem CID 154099945) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is 6-methyl-5-phenylpyrido[2,3-d]pyrimidine-2,4,7-triamine.
| Compound Name | 6-methyl-5-phenylpyrido[2,3-d]pyrimidine-2,4,7-triamine |
|---|---|
| PubChem CID | 154099945 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-methyl-5-phenylpyrido[2,3-d]pyrimidine-2,4,7-triamine |
| SMILES | Cc1c(N)nc2nc(N)nc(N)c2c1-c1ccccc1 |
| InChI | InChI=1S/C14H14N6/c1-7-9(8-5-3-2-4-6-8)10-12(16)19-14(17)20-13(10)18-11(7)15/h2-6H,1H3,(H6,15,16,17,18,19,20) |
| InChIKey | IVNRMOHZVFDAJT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |