C9H7F3N3O+ — CID 177168172
6-methyl-2-(trifluoromethyl)-3H-pyrido[4,3-d]pyrimidin-6-ium-4-one (PubChem CID 177168172) has the molecular formula C9H7F3N3O+ and a molecular weight of 230.17 g/mol. Its IUPAC name is 6-methyl-2-(trifluoromethyl)-3H-pyrido[4,3-d]pyrimidin-6-ium-4-one.
| Compound Name | 6-methyl-2-(trifluoromethyl)-3H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
|---|---|
| PubChem CID | 177168172 |
| Molecular Formula | C9H7F3N3O+ |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 6-methyl-2-(trifluoromethyl)-3H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
| SMILES | C[n+]1ccc2nc(C(F)(F)F)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C9H6F3N3O/c1-15-3-2-6-5(4-15)7(16)14-8(13-6)9(10,11)12/h2-4H,1H3/p+1 |
| InChIKey | ZXELWMQSKCCDAR-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|