C9H4F3IN2O — CID 136757886
7-iodo-2-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 136757886) has the molecular formula C9H4F3IN2O and a molecular weight of 340.04 g/mol. Its IUPAC name is 7-iodo-2-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 7-iodo-2-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136757886 |
| Molecular Formula | C9H4F3IN2O |
| Molecular Weight | 340.04 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | 7-iodo-2-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2cc(I)ccc12 |
| InChI | InChI=1S/C9H4F3IN2O/c10-9(11,12)8-14-6-3-4(13)1-2-5(6)7(16)15-8/h1-3H,(H,14,15,16) |
| InChIKey | QMNDRAZVUYOFJV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.04 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|