C14H15F3N2O — CID 137233002
2-(2,2-dimethylpropyl)-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 137233002) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 2-(2,2-dimethylpropyl)-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137233002 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | CC(C)(C)Cc1nc2cc(C(F)(F)F)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H15F3N2O/c1-13(2,3)7-11-18-10-6-8(14(15,16)17)4-5-9(10)12(20)19-11/h4-6H,7H2,1-3H3,(H,18,19,20) |
| InChIKey | DWMMVHULQYQBME-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |