C20H13F3N4O4 — CID 135938153
[4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 135938153) has the molecular formula C20H13F3N4O4 and a molecular weight of 430.34 g/mol. Its IUPAC name is [4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 135938153 |
| Molecular Formula | C20H13F3N4O4 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)OCc1nc2cc(C(F)(F)F)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H13F3N4O4/c21-20(22,23)10-5-6-13-14(7-10)24-16(25-18(13)29)9-31-17(28)8-15-11-3-1-2-4-12(11)19(30)27-26-15/h1-7H,8-9H2,(H,27,30)(H,24,25,29) |
| InChIKey | YXTHWVUAOAZFRJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |