C17H10F6N2O2 — CID 135690796
2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3H-quinazolin-4-one (PubChem CID 135690796) has the molecular formula C17H10F6N2O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135690796 |
| Molecular Formula | C17H10F6N2O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc2ccccc12 |
| InChI | InChI=1S/C17H10F6N2O2/c18-16(19,20)9-5-10(17(21,22)23)7-11(6-9)27-8-14-24-13-4-2-1-3-12(13)15(26)25-14/h1-7H,8H2,(H,24,25,26) |
| InChIKey | MUMFRYJNUDKNDV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |