C13H11F3N2OS2 — CID 136783614
2-[(2R)-1,4-dithian-2-yl]-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 136783614) has the molecular formula C13H11F3N2OS2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-[(2R)-1,4-dithian-2-yl]-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 2-[(2R)-1,4-dithian-2-yl]-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136783614 |
| Molecular Formula | C13H11F3N2OS2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-[(2R)-1,4-dithian-2-yl]-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c([C@@H]2CSCCS2)nc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C13H11F3N2OS2/c14-13(15,16)7-1-2-8-9(5-7)17-11(18-12(8)19)10-6-20-3-4-21-10/h1-2,5,10H,3-4,6H2,(H,17,18,19)/t10-/m0/s1 |
| InChIKey | SSSSCPONARFQBD-JTQLQIEISA-N |
| XLogP | 3.46 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |