C12H6F3N3O2 — CID 133083550
8-(trifluoromethyl)-1H-pyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 133083550) has the molecular formula C12H6F3N3O2 and a molecular weight of 281.19 g/mol. Its IUPAC name is 8-(trifluoromethyl)-1H-pyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 8-(trifluoromethyl)-1H-pyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 133083550 |
| Molecular Formula | C12H6F3N3O2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 8-(trifluoromethyl)-1H-pyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc3ccc(C(F)(F)F)cc3nc2[nH]1 |
| InChI | InChI=1S/C12H6F3N3O2/c13-12(14,15)6-2-1-5-3-7-9(16-8(5)4-6)17-11(20)18-10(7)19/h1-4H,(H2,16,17,18,19,20) |
| InChIKey | HGORTWPMRILTMD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|