C14H11F5N2O — CID 137054048
2-(3,3-difluorocyclopentyl)-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 137054048) has the molecular formula C14H11F5N2O and a molecular weight of 318.25 g/mol. Its IUPAC name is 2-(3,3-difluorocyclopentyl)-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 2-(3,3-difluorocyclopentyl)-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137054048 |
| Molecular Formula | C14H11F5N2O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-(3,3-difluorocyclopentyl)-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(C2CCC(F)(F)C2)nc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C14H11F5N2O/c15-13(16)4-3-7(6-13)11-20-10-5-8(14(17,18)19)1-2-9(10)12(22)21-11/h1-2,5,7H,3-4,6H2,(H,20,21,22) |
| InChIKey | UBPUNADLKLCZSK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |