C22H20F3N3O3 — CID 140551089
4-benzyl-1-[4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]piperidine-4-carboxylic acid (PubChem CID 140551089) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 4-benzyl-1-[4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 4-benzyl-1-[4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 140551089 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-benzyl-1-[4-oxo-7-(trifluoromethyl)-3H-quinazolin-2-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccccc2)CCN(c2nc3cc(C(F)(F)F)ccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C22H20F3N3O3/c23-22(24,25)15-6-7-16-17(12-15)26-20(27-18(16)29)28-10-8-21(9-11-28,19(30)31)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,30,31)(H,26,27,29) |
| InChIKey | MHIMBESQKORDCE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |