C22H23N3O5S — CID 140551085
4-benzyl-1-(7-methylsulfonyl-4-oxo-3H-quinazolin-2-yl)piperidine-4-carboxylic acid (PubChem CID 140551085) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-benzyl-1-(7-methylsulfonyl-4-oxo-3H-quinazolin-2-yl)piperidine-4-carboxylic acid.
| Compound Name | 4-benzyl-1-(7-methylsulfonyl-4-oxo-3H-quinazolin-2-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 140551085 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-benzyl-1-(7-methylsulfonyl-4-oxo-3H-quinazolin-2-yl)piperidine-4-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc2c(=O)[nH]c(N3CCC(Cc4ccccc4)(C(=O)O)CC3)nc2c1 |
| InChI | InChI=1S/C22H23N3O5S/c1-31(29,30)16-7-8-17-18(13-16)23-21(24-19(17)26)25-11-9-22(10-12-25,20(27)28)14-15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3,(H,27,28)(H,23,24,26) |
| InChIKey | PMUHGPKGYOYIAY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |