C13H11ClF2N2O — CID 137230504
6-chloro-2-[(1R)-3,3-difluorocyclopentyl]-3H-quinazolin-4-one (PubChem CID 137230504) has the molecular formula C13H11ClF2N2O and a molecular weight of 284.69 g/mol. Its IUPAC name is 6-chloro-2-[(1R)-3,3-difluorocyclopentyl]-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[(1R)-3,3-difluorocyclopentyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137230504 |
| Molecular Formula | C13H11ClF2N2O |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 6-chloro-2-[(1R)-3,3-difluorocyclopentyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c([C@@H]2CCC(F)(F)C2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C13H11ClF2N2O/c14-8-1-2-10-9(5-8)12(19)18-11(17-10)7-3-4-13(15,16)6-7/h1-2,5,7H,3-4,6H2,(H,17,18,19)/t7-/m1/s1 |
| InChIKey | NMHWOPQQRWBCQI-SSDOTTSWSA-N |
| XLogP | 3.48 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |