C13H12F3N3O — CID 136705332
2-pyrrolidin-3-yl-6-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 136705332) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-6-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 2-pyrrolidin-3-yl-6-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136705332 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-pyrrolidin-3-yl-6-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(C2CCNC2)nc2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C13H12F3N3O/c14-13(15,16)8-1-2-10-9(5-8)12(20)19-11(18-10)7-3-4-17-6-7/h1-2,5,7,17H,3-4,6H2,(H,18,19,20) |
| InChIKey | BFMGSLMIZFMFLY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |