C17H12ClF3N2OS — CID 136968750
2-(4-chloro-2-ethylsulfanylphenyl)-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 136968750) has the molecular formula C17H12ClF3N2OS and a molecular weight of 384.81 g/mol. Its IUPAC name is 2-(4-chloro-2-ethylsulfanylphenyl)-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 2-(4-chloro-2-ethylsulfanylphenyl)-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136968750 |
| Molecular Formula | C17H12ClF3N2OS |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-(4-chloro-2-ethylsulfanylphenyl)-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | CCSc1cc(Cl)ccc1-c1nc2cc(C(F)(F)F)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H12ClF3N2OS/c1-2-25-14-8-10(18)4-6-12(14)15-22-13-7-9(17(19,20)21)3-5-11(13)16(24)23-15/h3-8H,2H2,1H3,(H,22,23,24) |
| InChIKey | NCMWWZDHOCMDQV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |