C15H21ClN3O+ — CID 135622591
[(1S)-1-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethyl]-pentylazanium (PubChem CID 135622591) has the molecular formula C15H21ClN3O+ and a molecular weight of 294.81 g/mol. Its IUPAC name is [(1S)-1-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethyl]-pentylazanium.
| Compound Name | [(1S)-1-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethyl]-pentylazanium |
|---|---|
| PubChem CID | 135622591 |
| Molecular Formula | C15H21ClN3O+ |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [(1S)-1-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethyl]-pentylazanium |
| SMILES | CCCCC[NH2+][C@@H](C)c1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H20ClN3O/c1-3-4-5-8-17-10(2)14-18-13-9-11(16)6-7-12(13)15(20)19-14/h6-7,9-10,17H,3-5,8H2,1-2H3,(H,18,19,20)/p+1/t10-/m0/s1 |
| InChIKey | KKPCKMAJBWEVCQ-JTQLQIEISA-O |
| XLogP | 2.39 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|