C16H15ClN3O+ — CID 135677170
7-chloro-2-[(4-ethylpyridin-1-ium-1-yl)methyl]-3H-quinazolin-4-one (PubChem CID 135677170) has the molecular formula C16H15ClN3O+ and a molecular weight of 300.77 g/mol. Its IUPAC name is 7-chloro-2-[(4-ethylpyridin-1-ium-1-yl)methyl]-3H-quinazolin-4-one.
| Compound Name | 7-chloro-2-[(4-ethylpyridin-1-ium-1-yl)methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135677170 |
| Molecular Formula | C16H15ClN3O+ |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 7-chloro-2-[(4-ethylpyridin-1-ium-1-yl)methyl]-3H-quinazolin-4-one |
| SMILES | CCc1cc[n+](Cc2nc3cc(Cl)ccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H14ClN3O/c1-2-11-5-7-20(8-6-11)10-15-18-14-9-12(17)3-4-13(14)16(21)19-15/h3-9H,2,10H2,1H3/p+1 |
| InChIKey | FSOQOXNZLLCQRR-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|