C21H24ClN3O — CID 135751440
7-chloro-2-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-3H-quinazolin-4-one (PubChem CID 135751440) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 7-chloro-2-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 7-chloro-2-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135751440 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 7-chloro-2-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-3H-quinazolin-4-one |
| SMILES | CCc1ccc([C@H](NCc2nc3cc(Cl)ccc3c(=O)[nH]2)C(C)C)cc1 |
| InChI | InChI=1S/C21H24ClN3O/c1-4-14-5-7-15(8-6-14)20(13(2)3)23-12-19-24-18-11-16(22)9-10-17(18)21(26)25-19/h5-11,13,20,23H,4,12H2,1-3H3,(H,24,25,26)/t20-/m1/s1 |
| InChIKey | WWUONZLQROPPMG-HXUWFJFHSA-N |
| XLogP | 4.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |