C18H17BrClN3O2 — CID 135912359
2-[[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]methyl]-7-chloro-3H-quinazolin-4-one (PubChem CID 135912359) has the molecular formula C18H17BrClN3O2 and a molecular weight of 422.71 g/mol. Its IUPAC name is 2-[[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]methyl]-7-chloro-3H-quinazolin-4-one.
| Compound Name | 2-[[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]methyl]-7-chloro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135912359 |
| Molecular Formula | C18H17BrClN3O2 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-[[[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]amino]methyl]-7-chloro-3H-quinazolin-4-one |
| SMILES | COc1ccc([C@H](C)NCc2nc3cc(Cl)ccc3c(=O)[nH]2)cc1Br |
| InChI | InChI=1S/C18H17BrClN3O2/c1-10(11-3-6-16(25-2)14(19)7-11)21-9-17-22-15-8-12(20)4-5-13(15)18(24)23-17/h3-8,10,21H,9H2,1-2H3,(H,22,23,24)/t10-/m0/s1 |
| InChIKey | JGEZGPYTGNGLIC-JTQLQIEISA-N |
| XLogP | 4.20 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |