C19H21N3O3 — CID 135767367
6,7-dimethoxy-2-[[[(1R)-1-phenylethyl]amino]methyl]-3H-quinazolin-4-one (PubChem CID 135767367) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[[[(1R)-1-phenylethyl]amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-2-[[[(1R)-1-phenylethyl]amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135767367 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 6,7-dimethoxy-2-[[[(1R)-1-phenylethyl]amino]methyl]-3H-quinazolin-4-one |
| SMILES | COc1cc2nc(CN[C@H](C)c3ccccc3)[nH]c(=O)c2cc1OC |
| InChI | InChI=1S/C19H21N3O3/c1-12(13-7-5-4-6-8-13)20-11-18-21-15-10-17(25-3)16(24-2)9-14(15)19(23)22-18/h4-10,12,20H,11H2,1-3H3,(H,21,22,23)/t12-/m1/s1 |
| InChIKey | LWHLAZINCFBCBC-GFCCVEGCSA-N |
| XLogP | 2.79 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |