C13H15ClN4O2 — CID 136952206
3-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methylamino]butanamide (PubChem CID 136952206) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methylamino]butanamide.
| Compound Name | 3-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 136952206 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methylamino]butanamide |
| SMILES | CC(CC(N)=O)NCc1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-7(4-11(15)19)16-6-12-17-10-5-8(14)2-3-9(10)13(20)18-12/h2-3,5,7,16H,4,6H2,1H3,(H2,15,19)(H,17,18,20) |
| InChIKey | PSXWERONGVYZEZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |