C12H14ClN4O2+ — CID 135751172
(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl-[2-(methylamino)-2-oxoethyl]azanium (PubChem CID 135751172) has the molecular formula C12H14ClN4O2+ and a molecular weight of 281.72 g/mol. Its IUPAC name is (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl-[2-(methylamino)-2-oxoethyl]azanium.
| Compound Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl-[2-(methylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 135751172 |
| Molecular Formula | C12H14ClN4O2+ |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl-[2-(methylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)C[NH2+]Cc1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-14-11(18)6-15-5-10-16-9-4-7(13)2-3-8(9)12(19)17-10/h2-4,15H,5-6H2,1H3,(H,14,18)(H,16,17,19)/p+1 |
| InChIKey | WOLQSKRHDSWYGZ-UHFFFAOYSA-O |
| XLogP | -0.61 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |