C20H13ClN2O4 — CID 135850152
(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-hydroxynaphthalene-2-carboxylate (PubChem CID 135850152) has the molecular formula C20H13ClN2O4 and a molecular weight of 380.79 g/mol. Its IUPAC name is (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 135850152 |
| Molecular Formula | C20H13ClN2O4 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 3-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCc1nc2cc(Cl)ccc2c(=O)[nH]1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C20H13ClN2O4/c21-13-5-6-14-16(9-13)22-18(23-19(14)25)10-27-20(26)15-7-11-3-1-2-4-12(11)8-17(15)24/h1-9,24H,10H2,(H,22,23,25) |
| InChIKey | NJWMULGMFWMKPL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |