C18H14ClN3O4S — CID 135723676
(6-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 135723676) has the molecular formula C18H14ClN3O4S and a molecular weight of 403.85 g/mol. Its IUPAC name is (6-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | (6-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 135723676 |
| Molecular Formula | C18H14ClN3O4S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (6-chloro-4-oxo-3H-quinazolin-2-yl)methyl 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | NC(=O)CSc1ccccc1C(=O)OCc1nc2ccc(Cl)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H14ClN3O4S/c19-10-5-6-13-12(7-10)17(24)22-16(21-13)8-26-18(25)11-3-1-2-4-14(11)27-9-15(20)23/h1-7H,8-9H2,(H2,20,23)(H,21,22,24) |
| InChIKey | RSOWOMAQVAWFCC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |