C13H14ClN3O — CID 137000471
2-[(but-3-enylamino)methyl]-7-chloro-3H-quinazolin-4-one (PubChem CID 137000471) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is 2-[(but-3-enylamino)methyl]-7-chloro-3H-quinazolin-4-one.
| Compound Name | 2-[(but-3-enylamino)methyl]-7-chloro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137000471 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[(but-3-enylamino)methyl]-7-chloro-3H-quinazolin-4-one |
| SMILES | C=CCCNCc1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H14ClN3O/c1-2-3-6-15-8-12-16-11-7-9(14)4-5-10(11)13(18)17-12/h2,4-5,7,15H,1,3,6,8H2,(H,16,17,18) |
| InChIKey | KSXIZPPQOYXZTE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|