C14H12ClN5O — CID 136827796
7-chloro-2-[(pyridazin-3-ylmethylamino)methyl]-3H-quinazolin-4-one (PubChem CID 136827796) has the molecular formula C14H12ClN5O and a molecular weight of 301.74 g/mol. Its IUPAC name is 7-chloro-2-[(pyridazin-3-ylmethylamino)methyl]-3H-quinazolin-4-one.
| Compound Name | 7-chloro-2-[(pyridazin-3-ylmethylamino)methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136827796 |
| Molecular Formula | C14H12ClN5O |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 7-chloro-2-[(pyridazin-3-ylmethylamino)methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CNCc2cccnn2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H12ClN5O/c15-9-3-4-11-12(6-9)18-13(19-14(11)21)8-16-7-10-2-1-5-17-20-10/h1-6,16H,7-8H2,(H,18,19,21) |
| InChIKey | RAUDMKZNIBHHCB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |