C13H12ClN5O — CID 136921064
7-chloro-2-[[(1-methylpyrazol-3-yl)amino]methyl]-3H-quinazolin-4-one (PubChem CID 136921064) has the molecular formula C13H12ClN5O and a molecular weight of 289.73 g/mol. Its IUPAC name is 7-chloro-2-[[(1-methylpyrazol-3-yl)amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 7-chloro-2-[[(1-methylpyrazol-3-yl)amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136921064 |
| Molecular Formula | C13H12ClN5O |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 7-chloro-2-[[(1-methylpyrazol-3-yl)amino]methyl]-3H-quinazolin-4-one |
| SMILES | Cn1ccc(NCc2nc3cc(Cl)ccc3c(=O)[nH]2)n1 |
| InChI | InChI=1S/C13H12ClN5O/c1-19-5-4-11(18-19)15-7-12-16-10-6-8(14)2-3-9(10)13(20)17-12/h2-6H,7H2,1H3,(H,15,18)(H,16,17,20) |
| InChIKey | HTHWUTDRLCGXTR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |