About azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one
azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135624385) has the molecular formula C8H7ClF3N4O+
and a molecular weight of 267.62 g/mol. Its IUPAC name is azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 135624385 |
| Molecular Formula | C8H7ClF3N4O+ |
| Molecular Weight | 267.62 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2ncc(Cl)cc12.[NH4+] |
| InChI | InChI=1S/C8H3ClF3N3O.H3N/c9-3-1-4-5(13-2-3)14-7(8(10,11)12)15-6(4)16;/h1-2H,(H,13,14,15,16);1H3/p+1 |
| InChIKey | AQEGFHDLILGBNL-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one (CID 135624385) is azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one is O=c1[nH]c(C(F)(F)F)nc2ncc(Cl)cc12.[NH4+].
What is the InChIKey of azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is AQEGFHDLILGBNL-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H3ClF3N3O.H3N/c9-3-1-4-5(13-2-3)14-7(8(10,11)12)15-6(4)16;/h1-2H,(H,13,14,15,16);1H3/p+1.
What are the key properties of azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 267.62 g/mol, XLogP of 2.37, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 6-chloro-2-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 135624385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).