C13H9ClN2O — CID 71111092
2-chloro-8-methyl-5H-benzo[c][1,8]naphthyridin-6-one (PubChem CID 71111092) has the molecular formula C13H9ClN2O and a molecular weight of 244.68 g/mol. Its IUPAC name is 2-chloro-8-methyl-5H-benzo[c][1,8]naphthyridin-6-one.
| Compound Name | 2-chloro-8-methyl-5H-benzo[c][1,8]naphthyridin-6-one |
|---|---|
| PubChem CID | 71111092 |
| Molecular Formula | C13H9ClN2O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-chloro-8-methyl-5H-benzo[c][1,8]naphthyridin-6-one |
| SMILES | Cc1ccc2c(c1)c(=O)[nH]c1ncc(Cl)cc12 |
| InChI | InChI=1S/C13H9ClN2O/c1-7-2-3-9-10-5-8(14)6-15-12(10)16-13(17)11(9)4-7/h2-6H,1H3,(H,15,16,17) |
| InChIKey | ZGMJDJZDYLHOKW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|