C12H7ClN2O — CID 134324107
8-chloro-5H-benzo[c][1,7]naphthyridin-6-one (PubChem CID 134324107) has the molecular formula C12H7ClN2O and a molecular weight of 230.65 g/mol. Its IUPAC name is 8-chloro-5H-benzo[c][1,7]naphthyridin-6-one.
| Compound Name | 8-chloro-5H-benzo[c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 134324107 |
| Molecular Formula | C12H7ClN2O |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 8-chloro-5H-benzo[c][1,7]naphthyridin-6-one |
| SMILES | O=c1[nH]c2cnccc2c2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H7ClN2O/c13-7-1-2-8-9-3-4-14-6-11(9)15-12(16)10(8)5-7/h1-6H,(H,15,16) |
| InChIKey | JSVNHPXDPOJWQH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|