C14H8ClN5O — CID 137253655
14-chloro-17-diazenyl-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),4,6,11(16),12,14-heptaen-9-one (PubChem CID 137253655) has the molecular formula C14H8ClN5O and a molecular weight of 297.71 g/mol. Its IUPAC name is 14-chloro-17-diazenyl-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),4,6,11(16),12,14-heptaen-9-one.
| Compound Name | 14-chloro-17-diazenyl-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),4,6,11(16),12,14-heptaen-9-one |
|---|---|
| PubChem CID | 137253655 |
| Molecular Formula | C14H8ClN5O |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 14-chloro-17-diazenyl-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),4,6,11(16),12,14-heptaen-9-one |
| SMILES | [H]/N=N/c1c2cc(Cl)ccc2n2c(=O)c3ccncc3[nH]c12 |
| InChI | InChI=1S/C14H8ClN5O/c15-7-1-2-11-9(5-7)12(19-16)13-18-10-6-17-4-3-8(10)14(21)20(11)13/h1-6,16,18H/b19-16+ |
| InChIKey | VSBPUTCEABGNPD-KNTRCKAVSA-N |
| XLogP | 3.64 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|