C11H10Cl3N3 — CID 68524321
6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride (PubChem CID 68524321) has the molecular formula C11H10Cl3N3 and a molecular weight of 290.58 g/mol. Its IUPAC name is 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride.
| Compound Name | 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride |
|---|---|
| PubChem CID | 68524321 |
| Molecular Formula | C11H10Cl3N3 |
| Molecular Weight | 290.58 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(Cl)cc2c1[nH]c1cnccc12 |
| InChI | InChI=1S/C11H8ClN3.2ClH/c12-6-3-8-7-1-2-14-5-10(7)15-11(8)9(13)4-6;;/h1-5,15H,13H2;2*1H |
| InChIKey | MMPZVSRMOOFUMC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|