About 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride
6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride (PubChem CID 68524321) has the molecular formula C11H10Cl3N3
and a molecular weight of 290.58 g/mol. Its IUPAC name is 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride.
Molecular Properties
| Compound Name | 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride |
| PubChem CID | 68524321 |
| Molecular Formula | C11H10Cl3N3 |
| Molecular Weight | 290.58 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(Cl)cc2c1[nH]c1cnccc12 |
| InChI | InChI=1S/C11H8ClN3.2ClH/c12-6-3-8-7-1-2-14-5-10(7)15-11(8)9(13)4-6;;/h1-5,15H,13H2;2*1H |
| InChIKey | MMPZVSRMOOFUMC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride?
The IUPAC name of 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride (CID 68524321) is 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride.
What is the SMILES notation for 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride?
The canonical SMILES for 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride is Cl.Cl.Nc1cc(Cl)cc2c1[nH]c1cnccc12.
What is the InChIKey of 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride?
The InChIKey is MMPZVSRMOOFUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3.2ClH/c12-6-3-8-7-1-2-14-5-10(7)15-11(8)9(13)4-6;;/h1-5,15H,13H2;2*1H.
What are the key properties of 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride?
6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride has a molecular weight of 290.58 g/mol, XLogP of 3.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-9H-pyrido[3,4-b]indol-8-amine;dihydrochloride is sourced from PubChem (CID 68524321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).