C12H10ClN3O — CID 21362743
6-chloro-7-methoxy-9H-pyrido[3,4-b]indol-8-amine (PubChem CID 21362743) has the molecular formula C12H10ClN3O and a molecular weight of 247.69 g/mol. Its IUPAC name is 6-chloro-7-methoxy-9H-pyrido[3,4-b]indol-8-amine.
| Compound Name | 6-chloro-7-methoxy-9H-pyrido[3,4-b]indol-8-amine |
|---|---|
| PubChem CID | 21362743 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 6-chloro-7-methoxy-9H-pyrido[3,4-b]indol-8-amine |
| SMILES | COc1c(Cl)cc2c([nH]c3cnccc32)c1N |
| InChI | InChI=1S/C12H10ClN3O/c1-17-12-8(13)4-7-6-2-3-15-5-9(6)16-11(7)10(12)14/h2-5,16H,14H2,1H3 |
| InChIKey | SSJXCZMMXHUVFW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|