C13H12ClN3S — CID 67166595
6-chloro-7-ethylsulfanyl-9H-pyrido[3,4-b]indol-8-amine (PubChem CID 67166595) has the molecular formula C13H12ClN3S and a molecular weight of 277.78 g/mol. Its IUPAC name is 6-chloro-7-ethylsulfanyl-9H-pyrido[3,4-b]indol-8-amine.
| Compound Name | 6-chloro-7-ethylsulfanyl-9H-pyrido[3,4-b]indol-8-amine |
|---|---|
| PubChem CID | 67166595 |
| Molecular Formula | C13H12ClN3S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 6-chloro-7-ethylsulfanyl-9H-pyrido[3,4-b]indol-8-amine |
| SMILES | CCSc1c(Cl)cc2c([nH]c3cnccc32)c1N |
| InChI | InChI=1S/C13H12ClN3S/c1-2-18-13-9(14)5-8-7-3-4-16-6-10(7)17-12(8)11(13)15/h3-6,17H,2,15H2,1H3 |
| InChIKey | PHYZXFIBPLHHDC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|