C10H13N3O2 — CID 89209684
3-(ethylperoxymethyl)-1H-pyrrolo[2,3-c]pyridin-2-amine (PubChem CID 89209684) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(ethylperoxymethyl)-1H-pyrrolo[2,3-c]pyridin-2-amine.
| Compound Name | 3-(ethylperoxymethyl)-1H-pyrrolo[2,3-c]pyridin-2-amine |
|---|---|
| PubChem CID | 89209684 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-(ethylperoxymethyl)-1H-pyrrolo[2,3-c]pyridin-2-amine |
| SMILES | CCOOCc1c(N)[nH]c2cnccc12 |
| InChI | InChI=1S/C10H13N3O2/c1-2-14-15-6-8-7-3-4-12-5-9(7)13-10(8)11/h3-5,13H,2,6,11H2,1H3 |
| InChIKey | QELMAZOMMXLCMI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|